C15H21Cl2N3O2 — CID 120907158
2-[(2-chloro-4-nitrophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride (PubChem CID 120907158) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-[(2-chloro-4-nitrophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride.
| Compound Name | 2-[(2-chloro-4-nitrophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride |
|---|---|
| PubChem CID | 120907158 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[(2-chloro-4-nitrophenyl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CN2CCC3(CCNCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O2.ClH/c16-14-9-13(19(20)21)2-1-12(14)10-18-8-5-15(11-18)3-6-17-7-4-15;/h1-2,9,17H,3-8,10-11H2;1H |
| InChIKey | PITLWUMCEUWGQJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|