C14H19Cl2N3O2 — CID 120908226
2-[(3-chloro-4-nitrophenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (PubChem CID 120908226) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 2-[(3-chloro-4-nitrophenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
| Compound Name | 2-[(3-chloro-4-nitrophenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
|---|---|
| PubChem CID | 120908226 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-[(3-chloro-4-nitrophenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CN2CCC3(CCNC3)C2)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O2.ClH/c15-12-7-11(1-2-13(12)18(19)20)8-17-6-4-14(10-17)3-5-16-9-14;/h1-2,7,16H,3-6,8-10H2;1H |
| InChIKey | CJEUWIKKEJINQE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|