C9H4N6O8 — CID 163214713
1-(2,4-dinitrophenyl)-3,5-dinitropyrazole (PubChem CID 163214713) has the molecular formula C9H4N6O8 and a molecular weight of 324.17 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3,5-dinitropyrazole.
| Compound Name | 1-(2,4-dinitrophenyl)-3,5-dinitropyrazole |
|---|---|
| PubChem CID | 163214713 |
| Molecular Formula | C9H4N6O8 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3,5-dinitropyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H4N6O8/c16-12(17)5-1-2-6(7(3-5)13(18)19)11-9(15(22)23)4-8(10-11)14(20)21/h1-4H |
| InChIKey | GQEVVXYNZVIHIH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 190.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|