C13H16N6O4 — CID 15563781
1-(2,4-dinitrophenyl)-3-N,3-N,5-N,5-N-tetramethylpyrazole-3,5-diamine (PubChem CID 15563781) has the molecular formula C13H16N6O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3-N,3-N,5-N,5-N-tetramethylpyrazole-3,5-diamine.
| Compound Name | 1-(2,4-dinitrophenyl)-3-N,3-N,5-N,5-N-tetramethylpyrazole-3,5-diamine |
|---|---|
| PubChem CID | 15563781 |
| Molecular Formula | C13H16N6O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3-N,3-N,5-N,5-N-tetramethylpyrazole-3,5-diamine |
| SMILES | CN(C)c1cc(N(C)C)n(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H16N6O4/c1-15(2)12-8-13(16(3)4)17(14-12)10-6-5-9(18(20)21)7-11(10)19(22)23/h5-8H,1-4H3 |
| InChIKey | NRJSSVHMFNZFAS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|