C16H12N4O7 — CID 4749953
2-(2,4-dinitrophenyl)-7,8-dimethoxyphthalazin-1-one (PubChem CID 4749953) has the molecular formula C16H12N4O7 and a molecular weight of 372.29 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-7,8-dimethoxyphthalazin-1-one.
| Compound Name | 2-(2,4-dinitrophenyl)-7,8-dimethoxyphthalazin-1-one |
|---|---|
| PubChem CID | 4749953 |
| Molecular Formula | C16H12N4O7 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-7,8-dimethoxyphthalazin-1-one |
| SMILES | COc1ccc2cnn(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(=O)c2c1OC |
| InChI | InChI=1S/C16H12N4O7/c1-26-13-6-3-9-8-17-18(16(21)14(9)15(13)27-2)11-5-4-10(19(22)23)7-12(11)20(24)25/h3-8H,1-2H3 |
| InChIKey | VKSORJSTCSVIAC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 139.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|