C18H24N4O4 — CID 102571886
3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole (PubChem CID 102571886) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole.
| Compound Name | 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole |
|---|---|
| PubChem CID | 102571886 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole |
| SMILES | Cc1c(C(C)(C)C)nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C(C)(C)C |
| InChI | InChI=1S/C18H24N4O4/c1-11-15(17(2,3)4)19-20(16(11)18(5,6)7)13-9-8-12(21(23)24)10-14(13)22(25)26/h8-10H,1-7H3 |
| InChIKey | JXSPDHMAICXWHV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|