About 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole
3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole (PubChem CID 102571886) has the molecular formula C18H24N4O4
and a molecular weight of 360.41 g/mol. Its IUPAC name is 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole |
| PubChem CID | 102571886 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole |
| SMILES | Cc1c(C(C)(C)C)nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C(C)(C)C |
| InChI | InChI=1S/C18H24N4O4/c1-11-15(17(2,3)4)19-20(16(11)18(5,6)7)13-9-8-12(21(23)24)10-14(13)22(25)26/h8-10H,1-7H3 |
| InChIKey | JXSPDHMAICXWHV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole?
The IUPAC name of 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole (CID 102571886) is 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole.
What is the SMILES notation for 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole?
The canonical SMILES for 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole is Cc1c(C(C)(C)C)nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C(C)(C)C.
What is the InChIKey of 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole?
The InChIKey is JXSPDHMAICXWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O4/c1-11-15(17(2,3)4)19-20(16(11)18(5,6)7)13-9-8-12(21(23)24)10-14(13)22(25)26/h8-10H,1-7H3.
What are the key properties of 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole?
3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole has a molecular weight of 360.41 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-1-(2,4-dinitrophenyl)-4-methylpyrazole is sourced from PubChem (CID 102571886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).