C11H10ClN3O2 — CID 76849388
ethyl 1-(3-chlorophenyl)-1,2,4-triazole-3-carboxylate (PubChem CID 76849388) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is ethyl 1-(3-chlorophenyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 1-(3-chlorophenyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 76849388 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | ethyl 1-(3-chlorophenyl)-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1ncn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H10ClN3O2/c1-2-17-11(16)10-13-7-15(14-10)9-5-3-4-8(12)6-9/h3-7H,2H2,1H3 |
| InChIKey | FSPRBFCIJZJJAW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |