C9H8ClN3O — CID 69456348
[1-(3-chlorophenyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 69456348) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [1-(3-chlorophenyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 69456348 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | [1-(3-chlorophenyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1ncn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C9H8ClN3O/c10-7-2-1-3-8(4-7)13-6-11-9(5-14)12-13/h1-4,6,14H,5H2 |
| InChIKey | SSKSUTNKRZBTOP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |