C12H12Cl2N2O — CID 43156530
[5-chloro-1-(3-chlorophenyl)-3-ethylpyrazol-4-yl]methanol (PubChem CID 43156530) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is [5-chloro-1-(3-chlorophenyl)-3-ethylpyrazol-4-yl]methanol.
| Compound Name | [5-chloro-1-(3-chlorophenyl)-3-ethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 43156530 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | [5-chloro-1-(3-chlorophenyl)-3-ethylpyrazol-4-yl]methanol |
| SMILES | CCc1nn(-c2cccc(Cl)c2)c(Cl)c1CO |
| InChI | InChI=1S/C12H12Cl2N2O/c1-2-11-10(7-17)12(14)16(15-11)9-5-3-4-8(13)6-9/h3-6,17H,2,7H2,1H3 |
| InChIKey | DPOHBBHGYXVEDD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |