C15H19ClN2O — CID 82697489
[1-[(3-chlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol (PubChem CID 82697489) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is [1-[(3-chlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol.
| Compound Name | [1-[(3-chlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 82697489 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [1-[(3-chlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol |
| SMILES | CCc1nn(Cc2cccc(Cl)c2)c(CC)c1CO |
| InChI | InChI=1S/C15H19ClN2O/c1-3-14-13(10-19)15(4-2)18(17-14)9-11-6-5-7-12(16)8-11/h5-8,19H,3-4,9-10H2,1-2H3 |
| InChIKey | JKWZXKJKPZHWOH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |