C16H22BrN3 — CID 79225159
2-[1-[(3-bromophenyl)methyl]-3,5-diethylpyrazol-4-yl]ethanamine (PubChem CID 79225159) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-[1-[(3-bromophenyl)methyl]-3,5-diethylpyrazol-4-yl]ethanamine.
| Compound Name | 2-[1-[(3-bromophenyl)methyl]-3,5-diethylpyrazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 79225159 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[1-[(3-bromophenyl)methyl]-3,5-diethylpyrazol-4-yl]ethanamine |
| SMILES | CCc1nn(Cc2cccc(Br)c2)c(CC)c1CCN |
| InChI | InChI=1S/C16H22BrN3/c1-3-15-14(8-9-18)16(4-2)20(19-15)11-12-6-5-7-13(17)10-12/h5-7,10H,3-4,8-9,11,18H2,1-2H3 |
| InChIKey | ZRVNBJHTCHVROY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |