C15H18Cl2N2O — CID 82697288
[1-[(2,4-dichlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol (PubChem CID 82697288) has the molecular formula C15H18Cl2N2O and a molecular weight of 313.23 g/mol. Its IUPAC name is [1-[(2,4-dichlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol.
| Compound Name | [1-[(2,4-dichlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 82697288 |
| Molecular Formula | C15H18Cl2N2O |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [1-[(2,4-dichlorophenyl)methyl]-3,5-diethylpyrazol-4-yl]methanol |
| SMILES | CCc1nn(Cc2ccc(Cl)cc2Cl)c(CC)c1CO |
| InChI | InChI=1S/C15H18Cl2N2O/c1-3-14-12(9-20)15(4-2)19(18-14)8-10-5-6-11(16)7-13(10)17/h5-7,20H,3-4,8-9H2,1-2H3 |
| InChIKey | MFPVHKCXCKWKEB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |