C17H14Cl2N2O2 — CID 22387827
1-[(2,4-dichlorophenyl)methyl]-3-ethylindazole-6-carboxylic acid (PubChem CID 22387827) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-ethylindazole-6-carboxylic acid.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-ethylindazole-6-carboxylic acid |
|---|---|
| PubChem CID | 22387827 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-ethylindazole-6-carboxylic acid |
| SMILES | CCc1nn(Cc2ccc(Cl)cc2Cl)c2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-2-15-13-6-4-10(17(22)23)7-16(13)21(20-15)9-11-3-5-12(18)8-14(11)19/h3-8H,2,9H2,1H3,(H,22,23) |
| InChIKey | HRMLIIRMESDZSP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |