C17H16Cl2N4O — CID 162374177
3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]propanehydrazide (PubChem CID 162374177) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]propanehydrazide.
| Compound Name | 3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 162374177 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]propanehydrazide |
| SMILES | NNC(=O)CCc1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C17H16Cl2N4O/c18-12-6-5-11(14(19)9-12)10-23-16-4-2-1-3-13(16)15(22-23)7-8-17(24)21-20/h1-6,9H,7-8,10,20H2,(H,21,24) |
| InChIKey | HPJXBRYZMNPPGQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|