C39H37BrCl2N3OP — CID 162305899
[5-[[1-[(2,4-dichlorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylpentyl]-triphenylphosphanium bromide (PubChem CID 162305899) has the molecular formula C39H37BrCl2N3OP and a molecular weight of 745.53 g/mol. Its IUPAC name is [5-[[1-[(2,4-dichlorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylpentyl]-triphenylphosphanium bromide.
| Compound Name | [5-[[1-[(2,4-dichlorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylpentyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 162305899 |
| Molecular Formula | C39H37BrCl2N3OP |
| Molecular Weight | 745.53 g/mol |
| Exact Mass | 743.12 |
| IUPAC Name | [5-[[1-[(2,4-dichlorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylpentyl]-triphenylphosphanium bromide |
| SMILES | CC(CCNC(=O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C39H36Cl2N3OP.BrH/c1-29(24-26-46(32-13-5-2-6-14-32,33-15-7-3-8-16-33)34-17-9-4-10-18-34)23-25-42-39(45)38-35-19-11-12-20-37(35)44(43-38)28-30-21-22-31(40)27-36(30)41;/h2-22,27,29H,23-26,28H2,1H3;1H |
| InChIKey | GXYMXSBOUMDYCN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|