C21H19Cl2N5O — CID 129247222
N-[(1-cyanopyrrolidin-3-yl)methyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide (PubChem CID 129247222) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is N-[(1-cyanopyrrolidin-3-yl)methyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide.
| Compound Name | N-[(1-cyanopyrrolidin-3-yl)methyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 129247222 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[(1-cyanopyrrolidin-3-yl)methyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide |
| SMILES | N#CN1CCC(CNC(=O)c2nn(Cc3ccc(Cl)cc3Cl)c3ccccc23)C1 |
| InChI | InChI=1S/C21H19Cl2N5O/c22-16-6-5-15(18(23)9-16)12-28-19-4-2-1-3-17(19)20(26-28)21(29)25-10-14-7-8-27(11-14)13-24/h1-6,9,14H,7-8,10-12H2,(H,25,29) |
| InChIKey | ZMBFMJWKUJHYMF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|