C24H26Cl3N5O4 — CID 146443639
1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid (PubChem CID 146443639) has the molecular formula C24H26Cl3N5O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid.
| Compound Name | 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 146443639 |
| Molecular Formula | C24H26Cl3N5O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12.O=NN(CCCl)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H10Cl2N2O2.C9H16ClN3O2/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21;10-6-7-13(12-15)9(14)11-8-4-2-1-3-5-8/h1-7H,8H2,(H,20,21);8H,1-7H2,(H,11,14) |
| InChIKey | OHTCZDKZJUOYGD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|