C15H9Cl2IN2O2 — CID 71216306
1-[(2,4-dichlorophenyl)methyl]-5-iodoindazole-3-carboxylic acid (PubChem CID 71216306) has the molecular formula C15H9Cl2IN2O2 and a molecular weight of 447.06 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-5-iodoindazole-3-carboxylic acid.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-5-iodoindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 71216306 |
| Molecular Formula | C15H9Cl2IN2O2 |
| Molecular Weight | 447.06 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-5-iodoindazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccc(I)cc12 |
| InChI | InChI=1S/C15H9Cl2IN2O2/c16-9-2-1-8(12(17)5-9)7-20-13-4-3-10(18)6-11(13)14(19-20)15(21)22/h1-6H,7H2,(H,21,22) |
| InChIKey | HVUTZOXGSUYKTR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.06 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|