C17H12Cl2N2O2 — CID 67610724
2-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid (PubChem CID 67610724) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67610724 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C17H12Cl2N2O2/c1-10(17(22)23)16-13-4-2-3-5-15(13)21(20-16)9-11-6-7-12(18)8-14(11)19/h2-8H,1,9H2,(H,22,23) |
| InChIKey | OOBDKDUSPSOOBU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|