C35H40Cl2N5O+ — CID 163384535
N-[10-(4-amino-2-methylquinolin-1-ium-1-yl)decyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide (PubChem CID 163384535) has the molecular formula C35H40Cl2N5O+ and a molecular weight of 617.65 g/mol. Its IUPAC name is N-[10-(4-amino-2-methylquinolin-1-ium-1-yl)decyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide.
| Compound Name | N-[10-(4-amino-2-methylquinolin-1-ium-1-yl)decyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 163384535 |
| Molecular Formula | C35H40Cl2N5O+ |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | N-[10-(4-amino-2-methylquinolin-1-ium-1-yl)decyl]-1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxamide |
| SMILES | Cc1cc(N)c2ccccc2[n+]1CCCCCCCCCCNC(=O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C35H39Cl2N5O/c1-25-22-31(38)28-14-8-10-16-32(28)41(25)21-13-7-5-3-2-4-6-12-20-39-35(43)34-29-15-9-11-17-33(29)42(40-34)24-26-18-19-27(36)23-30(26)37/h8-11,14-19,22-23,38H,2-7,12-13,20-21,24H2,1H3,(H,39,43)/p+1 |
| InChIKey | XVADCRWDXURWFC-UHFFFAOYSA-O |
| XLogP | 8.27 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|