C16H14Cl2N2 — CID 143192052
1-[(2,4-dichlorophenyl)methyl]-3,6-dimethylindazole (PubChem CID 143192052) has the molecular formula C16H14Cl2N2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3,6-dimethylindazole.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3,6-dimethylindazole |
|---|---|
| PubChem CID | 143192052 |
| Molecular Formula | C16H14Cl2N2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3,6-dimethylindazole |
| SMILES | Cc1ccc2c(C)nn(Cc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C16H14Cl2N2/c1-10-3-6-14-11(2)19-20(16(14)7-10)9-12-4-5-13(17)8-15(12)18/h3-8H,9H2,1-2H3 |
| InChIKey | QNQVMESWDMQMTI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |