C19H16Cl2N2O2 — CID 58182915
methyl (Z)-3-[1-[(2,4-dichlorophenyl)methyl]-6-methylindazol-3-yl]prop-2-enoate (PubChem CID 58182915) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is methyl (Z)-3-[1-[(2,4-dichlorophenyl)methyl]-6-methylindazol-3-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[1-[(2,4-dichlorophenyl)methyl]-6-methylindazol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58182915 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | methyl (Z)-3-[1-[(2,4-dichlorophenyl)methyl]-6-methylindazol-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\c1nn(Cc2ccc(Cl)cc2Cl)c2cc(C)ccc12 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-12-3-6-15-17(7-8-19(24)25-2)22-23(18(15)9-12)11-13-4-5-14(20)10-16(13)21/h3-10H,11H2,1-2H3/b8-7- |
| InChIKey | MPGVPGLOXKWUSE-FPLPWBNLSA-N |
| XLogP | 4.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|