About (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide (PubChem CID 68914103) has the molecular formula C19H19Cl2N5O
and a molecular weight of 404.30 g/mol. Its IUPAC name is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide |
| PubChem CID | 68914103 |
| Molecular Formula | C19H19Cl2N5O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide |
| SMILES | CN(C)c1ccc2c(/C=C/C(=O)NN)nn(Cc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C19H19Cl2N5O/c1-25(2)14-5-6-15-17(7-8-19(27)23-22)24-26(18(15)10-14)11-12-3-4-13(20)9-16(12)21/h3-10H,11,22H2,1-2H3,(H,23,27)/b8-7+ |
| InChIKey | JGNGGKXSTOZYQG-BQYQJAHWSA-N |
| XLogP | 3.46 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide?
The IUPAC name of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide (CID 68914103) is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide.
What is the SMILES notation for (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide?
The canonical SMILES for (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide is CN(C)c1ccc2c(/C=C/C(=O)NN)nn(Cc3ccc(Cl)cc3Cl)c2c1.
What is the InChIKey of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide?
The InChIKey is JGNGGKXSTOZYQG-BQYQJAHWSA-N. The full InChI is InChI=1S/C19H19Cl2N5O/c1-25(2)14-5-6-15-17(7-8-19(27)23-22)24-26(18(15)10-14)11-12-3-4-13(20)9-16(12)21/h3-10H,11,22H2,1-2H3,(H,23,27)/b8-7+.
What are the key properties of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide?
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide has a molecular weight of 404.30 g/mol, XLogP of 3.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(dimethylamino)indazol-3-yl]prop-2-enehydrazide is sourced from PubChem (CID 68914103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).