C19H14Cl2F2N2O2 — CID 11661519
methyl (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enoate (PubChem CID 11661519) has the molecular formula C19H14Cl2F2N2O2 and a molecular weight of 411.24 g/mol. Its IUPAC name is methyl (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11661519 |
| Molecular Formula | C19H14Cl2F2N2O2 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | methyl (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1nn(Cc2ccc(Cl)cc2Cl)c2cc(C(F)F)ccc12 |
| InChI | InChI=1S/C19H14Cl2F2N2O2/c1-27-18(26)7-6-16-14-5-3-11(19(22)23)8-17(14)25(24-16)10-12-2-4-13(20)9-15(12)21/h2-9,19H,10H2,1H3/b7-6+ |
| InChIKey | BODKTWGXVGEGKP-VOTSOKGWSA-N |
| XLogP | 5.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|