C18H14ClF3N4O — CID 66900737
3-[1-[(4-chloro-2-fluorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enehydrazide (PubChem CID 66900737) has the molecular formula C18H14ClF3N4O and a molecular weight of 394.78 g/mol. Its IUPAC name is 3-[1-[(4-chloro-2-fluorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enehydrazide.
| Compound Name | 3-[1-[(4-chloro-2-fluorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 66900737 |
| Molecular Formula | C18H14ClF3N4O |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-[1-[(4-chloro-2-fluorophenyl)methyl]-6-(difluoromethyl)indazol-3-yl]prop-2-enehydrazide |
| SMILES | NNC(=O)C=Cc1nn(Cc2ccc(Cl)cc2F)c2cc(C(F)F)ccc12 |
| InChI | InChI=1S/C18H14ClF3N4O/c19-12-3-1-11(14(20)8-12)9-26-16-7-10(18(21)22)2-4-13(16)15(25-26)5-6-17(27)24-23/h1-8,18H,9,23H2,(H,24,27) |
| InChIKey | HBKFLCTZMQSRBG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|