C15H11ClF2N4O — CID 11638599
6-chloro-1-[(2,4-difluorophenyl)methyl]indazole-3-carbohydrazide (PubChem CID 11638599) has the molecular formula C15H11ClF2N4O and a molecular weight of 336.73 g/mol. Its IUPAC name is 6-chloro-1-[(2,4-difluorophenyl)methyl]indazole-3-carbohydrazide.
| Compound Name | 6-chloro-1-[(2,4-difluorophenyl)methyl]indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 11638599 |
| Molecular Formula | C15H11ClF2N4O |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 6-chloro-1-[(2,4-difluorophenyl)methyl]indazole-3-carbohydrazide |
| SMILES | NNC(=O)c1nn(Cc2ccc(F)cc2F)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H11ClF2N4O/c16-9-2-4-11-13(5-9)22(21-14(11)15(23)20-19)7-8-1-3-10(17)6-12(8)18/h1-6H,7,19H2,(H,20,23) |
| InChIKey | UFWZYKYFUOYRNW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|