C14H11ClFN5O — CID 66889396
1-[(4-chloro-2-fluorophenyl)methyl]pyrazolo[4,3-b]pyridine-3-carbohydrazide (PubChem CID 66889396) has the molecular formula C14H11ClFN5O and a molecular weight of 319.73 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]pyrazolo[4,3-b]pyridine-3-carbohydrazide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]pyrazolo[4,3-b]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 66889396 |
| Molecular Formula | C14H11ClFN5O |
| Molecular Weight | 319.73 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]pyrazolo[4,3-b]pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1nn(Cc2ccc(Cl)cc2F)c2cccnc12 |
| InChI | InChI=1S/C14H11ClFN5O/c15-9-4-3-8(10(16)6-9)7-21-11-2-1-5-18-12(11)13(20-21)14(22)19-17/h1-6H,7,17H2,(H,19,22) |
| InChIKey | HLNCHDMGHPKZNY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|