C18H17F2N3O4 — CID 130430062
methyl 1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]pyrazolo[4,3-b]pyridine-3-carboxylate (PubChem CID 130430062) has the molecular formula C18H17F2N3O4 and a molecular weight of 377.35 g/mol. Its IUPAC name is methyl 1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]pyrazolo[4,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]pyrazolo[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130430062 |
| Molecular Formula | C18H17F2N3O4 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | methyl 1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]pyrazolo[4,3-b]pyridine-3-carboxylate |
| SMILES | COCCOc1cc(F)c(Cn2nc(C(=O)OC)c3ncccc32)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O4/c1-25-6-7-27-11-8-13(19)12(14(20)9-11)10-23-15-4-3-5-21-16(15)17(22-23)18(24)26-2/h3-5,8-9H,6-7,10H2,1-2H3 |
| InChIKey | UHRVLLOQOCTUGV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|