C22H21F2N5O3 — CID 118974869
2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-methoxypyrimidin-4-amine (PubChem CID 118974869) has the molecular formula C22H21F2N5O3 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-methoxypyrimidin-4-amine.
| Compound Name | 2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 118974869 |
| Molecular Formula | C22H21F2N5O3 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-methoxypyrimidin-4-amine |
| SMILES | COCCOc1cc(F)c(Cn2nc(-c3ncc(OC)c(N)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C22H21F2N5O3/c1-30-7-8-32-13-9-16(23)15(17(24)10-13)12-29-18-6-4-3-5-14(18)20(28-29)22-26-11-19(31-2)21(25)27-22/h3-6,9-11H,7-8,12H2,1-2H3,(H2,25,26,27) |
| InChIKey | JLTLWTKEZQZRMM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|