C22H20F2N6O2 — CID 130449722
N-[[4-amino-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-5-yl]methyl]formamide (PubChem CID 130449722) has the molecular formula C22H20F2N6O2 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[[4-amino-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-5-yl]methyl]formamide.
| Compound Name | N-[[4-amino-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 130449722 |
| Molecular Formula | C22H20F2N6O2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[[4-amino-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-5-yl]methyl]formamide |
| SMILES | CCOc1cc(F)c(Cn2nc(-c3ncc(CNC=O)c(N)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C22H20F2N6O2/c1-2-32-14-7-17(23)16(18(24)8-14)11-30-19-6-4-3-5-15(19)20(29-30)22-27-10-13(9-26-12-31)21(25)28-22/h3-8,10,12H,2,9,11H2,1H3,(H,26,31)(H2,25,27,28) |
| InChIKey | UYVROKOVZRTPEQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|