C27H24F2N8O3 — CID 140701618
N-[[[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-5-methoxypyrimidin-4-yl]amino]methyl]pyrazine-2-carboxamide (PubChem CID 140701618) has the molecular formula C27H24F2N8O3 and a molecular weight of 546.54 g/mol. Its IUPAC name is N-[[[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-5-methoxypyrimidin-4-yl]amino]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-5-methoxypyrimidin-4-yl]amino]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 140701618 |
| Molecular Formula | C27H24F2N8O3 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | N-[[[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-5-methoxypyrimidin-4-yl]amino]methyl]pyrazine-2-carboxamide |
| SMILES | CCOc1cc(F)c(Cn2nc(-c3ncc(OC)c(NCNC(=O)c4cnccn4)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C27H24F2N8O3/c1-3-40-16-10-19(28)18(20(29)11-16)14-37-22-7-5-4-6-17(22)24(36-37)26-32-13-23(39-2)25(35-26)33-15-34-27(38)21-12-30-8-9-31-21/h4-13H,3,14-15H2,1-2H3,(H,34,38)(H,32,33,35) |
| InChIKey | DMTCLICHXYWVKU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|