C13H10Cl2N6O — CID 68913507
1-[(2,4-dichlorophenyl)methyl]pyrazolo[3,4-b]pyrazine-3-carbohydrazide (PubChem CID 68913507) has the molecular formula C13H10Cl2N6O and a molecular weight of 337.17 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]pyrazolo[3,4-b]pyrazine-3-carbohydrazide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]pyrazolo[3,4-b]pyrazine-3-carbohydrazide |
|---|---|
| PubChem CID | 68913507 |
| Molecular Formula | C13H10Cl2N6O |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]pyrazolo[3,4-b]pyrazine-3-carbohydrazide |
| SMILES | NNC(=O)c1nn(Cc2ccc(Cl)cc2Cl)c2nccnc12 |
| InChI | InChI=1S/C13H10Cl2N6O/c14-8-2-1-7(9(15)5-8)6-21-12-10(17-3-4-18-12)11(20-21)13(22)19-16/h1-5H,6,16H2,(H,19,22) |
| InChIKey | JGBGGJAMMBZQLK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|