C16H12Cl3N3O2 — CID 58796838
5,7-dichloro-1-[(2-chloro-4-methylphenyl)methyl]-N-hydroxyindazole-3-carboxamide (PubChem CID 58796838) has the molecular formula C16H12Cl3N3O2 and a molecular weight of 384.65 g/mol. Its IUPAC name is 5,7-dichloro-1-[(2-chloro-4-methylphenyl)methyl]-N-hydroxyindazole-3-carboxamide.
| Compound Name | 5,7-dichloro-1-[(2-chloro-4-methylphenyl)methyl]-N-hydroxyindazole-3-carboxamide |
|---|---|
| PubChem CID | 58796838 |
| Molecular Formula | C16H12Cl3N3O2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 5,7-dichloro-1-[(2-chloro-4-methylphenyl)methyl]-N-hydroxyindazole-3-carboxamide |
| SMILES | Cc1ccc(Cn2nc(C(=O)NO)c3cc(Cl)cc(Cl)c32)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl3N3O2/c1-8-2-3-9(12(18)4-8)7-22-15-11(5-10(17)6-13(15)19)14(20-22)16(23)21-24/h2-6,24H,7H2,1H3,(H,21,23) |
| InChIKey | VKWPEKKUJGDUBU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|