C15H18ClN3O2 — CID 106869336
methyl 1-[(2-chloro-4-methylphenyl)methyl]-5-propan-2-yltriazole-4-carboxylate (PubChem CID 106869336) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is methyl 1-[(2-chloro-4-methylphenyl)methyl]-5-propan-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-[(2-chloro-4-methylphenyl)methyl]-5-propan-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 106869336 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | methyl 1-[(2-chloro-4-methylphenyl)methyl]-5-propan-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2ccc(C)cc2Cl)c1C(C)C |
| InChI | InChI=1S/C15H18ClN3O2/c1-9(2)14-13(15(20)21-4)17-18-19(14)8-11-6-5-10(3)7-12(11)16/h5-7,9H,8H2,1-4H3 |
| InChIKey | MWOLQTIVOIUASF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |