C12H14BrN3O2S — CID 102643932
methyl 1-[(4-bromothiophen-2-yl)methyl]-5-propan-2-yltriazole-4-carboxylate (PubChem CID 102643932) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is methyl 1-[(4-bromothiophen-2-yl)methyl]-5-propan-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-[(4-bromothiophen-2-yl)methyl]-5-propan-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 102643932 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | methyl 1-[(4-bromothiophen-2-yl)methyl]-5-propan-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2cc(Br)cs2)c1C(C)C |
| InChI | InChI=1S/C12H14BrN3O2S/c1-7(2)11-10(12(17)18-3)14-15-16(11)5-9-4-8(13)6-19-9/h4,6-7H,5H2,1-3H3 |
| InChIKey | BTNNLTZXBACVLM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |