C14H15BrClN3O2 — CID 102644053
methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-propan-2-yltriazole-4-carboxylate (PubChem CID 102644053) has the molecular formula C14H15BrClN3O2 and a molecular weight of 372.65 g/mol. Its IUPAC name is methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-propan-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-propan-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 102644053 |
| Molecular Formula | C14H15BrClN3O2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-propan-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2ccc(Br)cc2Cl)c1C(C)C |
| InChI | InChI=1S/C14H15BrClN3O2/c1-8(2)13-12(14(20)21-3)17-18-19(13)7-9-4-5-10(15)6-11(9)16/h4-6,8H,7H2,1-3H3 |
| InChIKey | SPIVRKFBXGCPSZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |