C13H13BrClN3O3 — CID 102643742
methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-(methoxymethyl)triazole-4-carboxylate (PubChem CID 102643742) has the molecular formula C13H13BrClN3O3 and a molecular weight of 374.62 g/mol. Its IUPAC name is methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-(methoxymethyl)triazole-4-carboxylate.
| Compound Name | methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-(methoxymethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 102643742 |
| Molecular Formula | C13H13BrClN3O3 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | methyl 1-[(4-bromo-2-chlorophenyl)methyl]-5-(methoxymethyl)triazole-4-carboxylate |
| SMILES | COCc1c(C(=O)OC)nnn1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H13BrClN3O3/c1-20-7-11-12(13(19)21-2)16-17-18(11)6-8-3-4-9(14)5-10(8)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | OIMQVKCUBVKOAA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |