C12H17N5O3 — CID 102643750
methyl 1-[(1-ethylpyrazol-4-yl)methyl]-5-(methoxymethyl)triazole-4-carboxylate (PubChem CID 102643750) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 1-[(1-ethylpyrazol-4-yl)methyl]-5-(methoxymethyl)triazole-4-carboxylate.
| Compound Name | methyl 1-[(1-ethylpyrazol-4-yl)methyl]-5-(methoxymethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 102643750 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl 1-[(1-ethylpyrazol-4-yl)methyl]-5-(methoxymethyl)triazole-4-carboxylate |
| SMILES | CCn1cc(Cn2nnc(C(=O)OC)c2COC)cn1 |
| InChI | InChI=1S/C12H17N5O3/c1-4-16-6-9(5-13-16)7-17-10(8-19-2)11(14-15-17)12(18)20-3/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | SMTAVCOXKCSWON-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |