C8H12N4O4 — CID 102643595
methyl 1-(2-amino-2-oxoethyl)-5-(methoxymethyl)triazole-4-carboxylate (PubChem CID 102643595) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is methyl 1-(2-amino-2-oxoethyl)-5-(methoxymethyl)triazole-4-carboxylate.
| Compound Name | methyl 1-(2-amino-2-oxoethyl)-5-(methoxymethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 102643595 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl 1-(2-amino-2-oxoethyl)-5-(methoxymethyl)triazole-4-carboxylate |
| SMILES | COCc1c(C(=O)OC)nnn1CC(N)=O |
| InChI | InChI=1S/C8H12N4O4/c1-15-4-5-7(8(14)16-2)10-11-12(5)3-6(9)13/h3-4H2,1-2H3,(H2,9,13) |
| InChIKey | SQFZOFSNLRNJLM-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |