C13H19N5O3 — CID 102643649
methyl 5-(methoxymethyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate (PubChem CID 102643649) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is methyl 5-(methoxymethyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate.
| Compound Name | methyl 5-(methoxymethyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 102643649 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | methyl 5-(methoxymethyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]triazole-4-carboxylate |
| SMILES | COCc1c(C(=O)OC)nnn1Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C13H19N5O3/c1-9(2)17-6-5-10(15-17)7-18-11(8-20-3)12(14-16-18)13(19)21-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | XGCVMDPIJXRASO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |