C13H20N6O2 — CID 103121493
5-(aminomethyl)-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazole-4-carboxylic acid (PubChem CID 103121493) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103121493 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 5-(aminomethyl)-1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazole-4-carboxylic acid |
| SMILES | CCC(CC)n1ccc(Cn2nnc(C(=O)O)c2CN)n1 |
| InChI | InChI=1S/C13H20N6O2/c1-3-10(4-2)18-6-5-9(16-18)8-19-11(7-14)12(13(20)21)15-17-19/h5-6,10H,3-4,7-8,14H2,1-2H3,(H,20,21) |
| InChIKey | BHTPCBJNZCDQEE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |