C11H16N6O2 — CID 79317861
ethyl 1-[(1-propan-2-ylpyrazol-3-yl)methyl]tetrazole-5-carboxylate (PubChem CID 79317861) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is ethyl 1-[(1-propan-2-ylpyrazol-3-yl)methyl]tetrazole-5-carboxylate.
| Compound Name | ethyl 1-[(1-propan-2-ylpyrazol-3-yl)methyl]tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 79317861 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | ethyl 1-[(1-propan-2-ylpyrazol-3-yl)methyl]tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C11H16N6O2/c1-4-19-11(18)10-12-14-15-17(10)7-9-5-6-16(13-9)8(2)3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | CYNVCYVJUGXSSZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |