C19H14ClFN2O4 — CID 68912253
1-[(2-chloro-4-fluorophenyl)methyl]-3-[(E)-3-methoxy-3-oxoprop-1-enyl]indazole-6-carboxylic acid (PubChem CID 68912253) has the molecular formula C19H14ClFN2O4 and a molecular weight of 388.78 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-3-[(E)-3-methoxy-3-oxoprop-1-enyl]indazole-6-carboxylic acid.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-[(E)-3-methoxy-3-oxoprop-1-enyl]indazole-6-carboxylic acid |
|---|---|
| PubChem CID | 68912253 |
| Molecular Formula | C19H14ClFN2O4 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-[(E)-3-methoxy-3-oxoprop-1-enyl]indazole-6-carboxylic acid |
| SMILES | COC(=O)/C=C/c1nn(Cc2ccc(F)cc2Cl)c2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C19H14ClFN2O4/c1-27-18(24)7-6-16-14-5-3-11(19(25)26)8-17(14)23(22-16)10-12-2-4-13(21)9-15(12)20/h2-9H,10H2,1H3,(H,25,26)/b7-6+ |
| InChIKey | SWEAQGMLCOPGIO-VOTSOKGWSA-N |
| XLogP | 3.76 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|