C15H18ClN3 — CID 82592556
1-(3-chlorophenyl)-3-ethyl-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 82592556) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-ethyl-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 1-(3-chlorophenyl)-3-ethyl-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 82592556 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-ethyl-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | CCc1nn(-c2cccc(Cl)c2)c2c1C(N)CCC2 |
| InChI | InChI=1S/C15H18ClN3/c1-2-13-15-12(17)7-4-8-14(15)19(18-13)11-6-3-5-10(16)9-11/h3,5-6,9,12H,2,4,7-8,17H2,1H3 |
| InChIKey | DTLLYMVIDUXIST-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |