C13H16FN3 — CID 166495018
3-(2,2-dimethylpropyl)-1-(3-fluorophenyl)-1,2,4-triazole (PubChem CID 166495018) has the molecular formula C13H16FN3 and a molecular weight of 233.29 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-1-(3-fluorophenyl)-1,2,4-triazole.
| Compound Name | 3-(2,2-dimethylpropyl)-1-(3-fluorophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 166495018 |
| Molecular Formula | C13H16FN3 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-1-(3-fluorophenyl)-1,2,4-triazole |
| SMILES | CC(C)(C)Cc1ncn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H16FN3/c1-13(2,3)8-12-15-9-17(16-12)11-6-4-5-10(14)7-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | CQVJLLSKLXFNGE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |