C27H36N8 — CID 58161891
2-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-6-[2-[6-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-2-pyridinyl]propan-2-yl]pyridine (PubChem CID 58161891) has the molecular formula C27H36N8 and a molecular weight of 472.64 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-6-[2-[6-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-2-pyridinyl]propan-2-yl]pyridine.
| Compound Name | 2-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-6-[2-[6-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-2-pyridinyl]propan-2-yl]pyridine |
|---|---|
| PubChem CID | 58161891 |
| Molecular Formula | C27H36N8 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 2-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-6-[2-[6-[3-(2,2-dimethylpropyl)-1,2,4-triazol-1-yl]-2-pyridinyl]propan-2-yl]pyridine |
| SMILES | CC(C)(C)Cc1ncn(-c2cccc(C(C)(C)c3cccc(-n4cnc(CC(C)(C)C)n4)n3)n2)n1 |
| InChI | InChI=1S/C27H36N8/c1-25(2,3)15-21-28-17-34(32-21)23-13-9-11-19(30-23)27(7,8)20-12-10-14-24(31-20)35-18-29-22(33-35)16-26(4,5)6/h9-14,17-18H,15-16H2,1-8H3 |
| InChIKey | NKGIWQABODBUFL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |