C28H36N6 — CID 153290521
2-(4-tert-butylimidazol-1-yl)-6-[2-[6-(4-tert-butyl-3-methyl-2H-imidazol-3-ium-2-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine (PubChem CID 153290521) has the molecular formula C28H36N6 and a molecular weight of 456.64 g/mol. Its IUPAC name is 2-(4-tert-butylimidazol-1-yl)-6-[2-[6-(4-tert-butyl-3-methyl-2H-imidazol-3-ium-2-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine.
| Compound Name | 2-(4-tert-butylimidazol-1-yl)-6-[2-[6-(4-tert-butyl-3-methyl-2H-imidazol-3-ium-2-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine |
|---|---|
| PubChem CID | 153290521 |
| Molecular Formula | C28H36N6 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 2-(4-tert-butylimidazol-1-yl)-6-[2-[6-(4-tert-butyl-3-methyl-2H-imidazol-3-ium-2-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine |
| SMILES | C[n+]1[c-]n(-c2cccc(C(C)(C)c3cccc(-n4cnc(C(C)(C)C)c4)n3)n2)cc1C(C)(C)C |
| InChI | InChI=1S/C28H36N6/c1-26(2,3)22-16-33(18-29-22)24-14-10-12-20(30-24)28(7,8)21-13-11-15-25(31-21)34-17-23(27(4,5)6)32(9)19-34/h10-18H,1-9H3 |
| InChIKey | PBOWRWOGNAPRSQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|