C23H20ClNO5 — CID 102260133
ethyl 6-(4-chlorophenyl)-4-hydroxy-2-methyl-3-[(4-nitrophenyl)methyl]benzoate (PubChem CID 102260133) has the molecular formula C23H20ClNO5 and a molecular weight of 425.87 g/mol. Its IUPAC name is ethyl 6-(4-chlorophenyl)-4-hydroxy-2-methyl-3-[(4-nitrophenyl)methyl]benzoate.
| Compound Name | ethyl 6-(4-chlorophenyl)-4-hydroxy-2-methyl-3-[(4-nitrophenyl)methyl]benzoate |
|---|---|
| PubChem CID | 102260133 |
| Molecular Formula | C23H20ClNO5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | ethyl 6-(4-chlorophenyl)-4-hydroxy-2-methyl-3-[(4-nitrophenyl)methyl]benzoate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)cc(O)c(Cc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C23H20ClNO5/c1-3-30-23(27)22-14(2)19(12-15-4-10-18(11-5-15)25(28)29)21(26)13-20(22)16-6-8-17(24)9-7-16/h4-11,13,26H,3,12H2,1-2H3 |
| InChIKey | YMBQDXNJEAQOQA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|