C24H23ClN4O6 — CID 135964553
ethyl 5-(4-chlorophenyl)-1-[2-[(2E)-2-[(2-hydroxy-4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,4-dimethylpyrrole-3-carboxylate (PubChem CID 135964553) has the molecular formula C24H23ClN4O6 and a molecular weight of 498.92 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-1-[2-[(2E)-2-[(2-hydroxy-4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,4-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-1-[2-[(2E)-2-[(2-hydroxy-4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,4-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135964553 |
| Molecular Formula | C24H23ClN4O6 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-1-[2-[(2E)-2-[(2-hydroxy-4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,4-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(-c2ccc(Cl)cc2)n(CC(=O)N/N=C/c2ccc([N+](=O)[O-])cc2O)c1C |
| InChI | InChI=1S/C24H23ClN4O6/c1-4-35-24(32)22-14(2)23(16-5-8-18(25)9-6-16)28(15(22)3)13-21(31)27-26-12-17-7-10-19(29(33)34)11-20(17)30/h5-12,30H,4,13H2,1-3H3,(H,27,31)/b26-12+ |
| InChIKey | CIQHVTCVGBBTCJ-RPPGKUMJSA-N |
| XLogP | 4.37 |
| TPSA | 136.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|