About 1-bromobutyl 1H-indole-5-carboxylate
1-bromobutyl 1H-indole-5-carboxylate (PubChem CID 70108962) has the molecular formula C13H14BrNO2
and a molecular weight of 296.16 g/mol. Its IUPAC name is 1-bromobutyl 1H-indole-5-carboxylate.
Molecular Properties
| Compound Name | 1-bromobutyl 1H-indole-5-carboxylate |
| PubChem CID | 70108962 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-bromobutyl 1H-indole-5-carboxylate |
| SMILES | CCCC(Br)OC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C13H14BrNO2/c1-2-3-12(14)17-13(16)10-4-5-11-9(8-10)6-7-15-11/h4-8,12,15H,2-3H2,1H3 |
| InChIKey | DLPXTBDJCGTNAA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromobutyl 1H-indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromobutyl 1H-indole-5-carboxylate?
The IUPAC name of 1-bromobutyl 1H-indole-5-carboxylate (CID 70108962) is 1-bromobutyl 1H-indole-5-carboxylate.
What is the SMILES notation for 1-bromobutyl 1H-indole-5-carboxylate?
The canonical SMILES for 1-bromobutyl 1H-indole-5-carboxylate is CCCC(Br)OC(=O)c1ccc2[nH]ccc2c1.
What is the InChIKey of 1-bromobutyl 1H-indole-5-carboxylate?
The InChIKey is DLPXTBDJCGTNAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO2/c1-2-3-12(14)17-13(16)10-4-5-11-9(8-10)6-7-15-11/h4-8,12,15H,2-3H2,1H3.
What are the key properties of 1-bromobutyl 1H-indole-5-carboxylate?
1-bromobutyl 1H-indole-5-carboxylate has a molecular weight of 296.16 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromobutyl 1H-indole-5-carboxylate is sourced from PubChem (CID 70108962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).